C14H14N2O — CID 124638636
(2S,3R)-3-amino-2-methoxy-3-naphthalen-1-ylpropanenitrile (PubChem CID 124638636) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is (2S,3R)-3-amino-2-methoxy-3-naphthalen-1-ylpropanenitrile.
| Compound Name | (2S,3R)-3-amino-2-methoxy-3-naphthalen-1-ylpropanenitrile |
|---|---|
| PubChem CID | 124638636 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | (2S,3R)-3-amino-2-methoxy-3-naphthalen-1-ylpropanenitrile |
| SMILES | CO[C@H](C#N)[C@H](N)c1cccc2ccccc12 |
| InChI | InChI=1S/C14H14N2O/c1-17-13(9-15)14(16)12-8-4-6-10-5-2-3-7-11(10)12/h2-8,13-14H,16H2,1H3/t13-,14-/m1/s1 |
| InChIKey | HMHZONGTMLMDOM-ZIAGYGMSSA-N |
| XLogP | 2.38 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |