C19H39NO3 — CID 124639855
ethyl (2S,3S)-2-amino-3-hydroxy-15-methylhexadecanoate (PubChem CID 124639855) has the molecular formula C19H39NO3 and a molecular weight of 329.53 g/mol. Its IUPAC name is ethyl (2S,3S)-2-amino-3-hydroxy-15-methylhexadecanoate.
| Compound Name | ethyl (2S,3S)-2-amino-3-hydroxy-15-methylhexadecanoate |
|---|---|
| PubChem CID | 124639855 |
| Molecular Formula | C19H39NO3 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.29 |
| IUPAC Name | ethyl (2S,3S)-2-amino-3-hydroxy-15-methylhexadecanoate |
| SMILES | CCOC(=O)[C@@H](N)[C@@H](O)CCCCCCCCCCCC(C)C |
| InChI | InChI=1S/C19H39NO3/c1-4-23-19(22)18(20)17(21)15-13-11-9-7-5-6-8-10-12-14-16(2)3/h16-18,21H,4-15,20H2,1-3H3/t17-,18-/m0/s1 |
| InChIKey | QCSTXHIBWMQIGZ-ROUUACIJSA-N |
| XLogP | 4.18 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|