About methyl 4-[1-[[(2S)-4,4-dimethylpiperidine-2-carbonyl]amino]cyclopropyl]benzoate
methyl 4-[1-[[(2S)-4,4-dimethylpiperidine-2-carbonyl]amino]cyclopropyl]benzoate (PubChem CID 124645144) has the molecular formula C19H26N2O3
and a molecular weight of 330.43 g/mol. Its IUPAC name is methyl 4-[1-[[(2S)-4,4-dimethylpiperidine-2-carbonyl]amino]cyclopropyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[1-[[(2S)-4,4-dimethylpiperidine-2-carbonyl]amino]cyclopropyl]benzoate |
| PubChem CID | 124645144 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | methyl 4-[1-[[(2S)-4,4-dimethylpiperidine-2-carbonyl]amino]cyclopropyl]benzoate |
| SMILES | COC(=O)c1ccc(C2(NC(=O)[C@@H]3CC(C)(C)CCN3)CC2)cc1 |
| InChI | InChI=1S/C19H26N2O3/c1-18(2)10-11-20-15(12-18)16(22)21-19(8-9-19)14-6-4-13(5-7-14)17(23)24-3/h4-7,15,20H,8-12H2,1-3H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | ZKBVBCADTLQGGK-HNNXBMFYSA-N |
| XLogP | 2.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[1-[[(2S)-4,4-dimethylpiperidine-2-carbonyl]amino]cyclopropyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[1-[[(2S)-4,4-dimethylpiperidine-2-carbonyl]amino]cyclopropyl]benzoate?
The IUPAC name of methyl 4-[1-[[(2S)-4,4-dimethylpiperidine-2-carbonyl]amino]cyclopropyl]benzoate (CID 124645144) is methyl 4-[1-[[(2S)-4,4-dimethylpiperidine-2-carbonyl]amino]cyclopropyl]benzoate.
What is the SMILES notation for methyl 4-[1-[[(2S)-4,4-dimethylpiperidine-2-carbonyl]amino]cyclopropyl]benzoate?
The canonical SMILES for methyl 4-[1-[[(2S)-4,4-dimethylpiperidine-2-carbonyl]amino]cyclopropyl]benzoate is COC(=O)c1ccc(C2(NC(=O)[C@@H]3CC(C)(C)CCN3)CC2)cc1.
What is the InChIKey of methyl 4-[1-[[(2S)-4,4-dimethylpiperidine-2-carbonyl]amino]cyclopropyl]benzoate?
The InChIKey is ZKBVBCADTLQGGK-HNNXBMFYSA-N. The full InChI is InChI=1S/C19H26N2O3/c1-18(2)10-11-20-15(12-18)16(22)21-19(8-9-19)14-6-4-13(5-7-14)17(23)24-3/h4-7,15,20H,8-12H2,1-3H3,(H,21,22)/t15-/m0/s1.
What are the key properties of methyl 4-[1-[[(2S)-4,4-dimethylpiperidine-2-carbonyl]amino]cyclopropyl]benzoate?
methyl 4-[1-[[(2S)-4,4-dimethylpiperidine-2-carbonyl]amino]cyclopropyl]benzoate has a molecular weight of 330.43 g/mol, XLogP of 2.36, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[1-[[(2S)-4,4-dimethylpiperidine-2-carbonyl]amino]cyclopropyl]benzoate is sourced from PubChem (CID 124645144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).