C26H29FN2O2S — CID 124649289
(5Z)-5-[[(4R)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 124649289) has the molecular formula C26H29FN2O2S and a molecular weight of 452.60 g/mol. Its IUPAC name is (5Z)-5-[[(4R)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[(4R)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124649289 |
| Molecular Formula | C26H29FN2O2S |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (5Z)-5-[[(4R)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCN1c2cc(C)c(/C=C3\SC(=O)N(Cc4ccc(F)cc4)C3=O)cc2[C@H](C)CC1(C)C |
| InChI | InChI=1S/C26H29FN2O2S/c1-6-29-22-11-16(2)19(12-21(22)17(3)14-26(29,4)5)13-23-24(30)28(25(31)32-23)15-18-7-9-20(27)10-8-18/h7-13,17H,6,14-15H2,1-5H3/b23-13-/t17-/m1/s1 |
| InChIKey | PCZLDEKVMDOYPO-SUVVMJBMSA-N |
| XLogP | 6.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|