About 2-O-ethyl 4-O-methyl 5-(methoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate
2-O-ethyl 4-O-methyl 5-(methoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate (PubChem CID 1246494) has the molecular formula C12H15NO6S
and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-O-ethyl 4-O-methyl 5-(methoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-ethyl 4-O-methyl 5-(methoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate |
| PubChem CID | 1246494 |
| Molecular Formula | C12H15NO6S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-O-ethyl 4-O-methyl 5-(methoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)OC)c(C(=O)OC)c1C |
| InChI | InChI=1S/C12H15NO6S/c1-5-19-11(15)8-6(2)7(10(14)17-3)9(20-8)13-12(16)18-4/h5H2,1-4H3,(H,13,16) |
| InChIKey | WLDBUIYTNRPQRJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 2-O-ethyl 4-O-methyl 5-(methoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-ethyl 4-O-methyl 5-(methoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate?
The IUPAC name of 2-O-ethyl 4-O-methyl 5-(methoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate (CID 1246494) is 2-O-ethyl 4-O-methyl 5-(methoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate.
What is the SMILES notation for 2-O-ethyl 4-O-methyl 5-(methoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate?
The canonical SMILES for 2-O-ethyl 4-O-methyl 5-(methoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate is CCOC(=O)c1sc(NC(=O)OC)c(C(=O)OC)c1C.
What is the InChIKey of 2-O-ethyl 4-O-methyl 5-(methoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate?
The InChIKey is WLDBUIYTNRPQRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO6S/c1-5-19-11(15)8-6(2)7(10(14)17-3)9(20-8)13-12(16)18-4/h5H2,1-4H3,(H,13,16).
What are the key properties of 2-O-ethyl 4-O-methyl 5-(methoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate?
2-O-ethyl 4-O-methyl 5-(methoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate has a molecular weight of 301.32 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-ethyl 4-O-methyl 5-(methoxycarbonylamino)-3-methylthiophene-2,4-dicarboxylate is sourced from PubChem (CID 1246494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).