C16H19NO6 — CID 124650170
(3R,5S)-5-acetyloxy-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid (PubChem CID 124650170) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is (3R,5S)-5-acetyloxy-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid.
| Compound Name | (3R,5S)-5-acetyloxy-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 124650170 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (3R,5S)-5-acetyloxy-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid |
| SMILES | CC(=O)O[C@H]1C[C@@H](C(=O)O)CN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C16H19NO6/c1-11(18)23-14-7-13(15(19)20)8-17(9-14)16(21)22-10-12-5-3-2-4-6-12/h2-6,13-14H,7-10H2,1H3,(H,19,20)/t13-,14+/m1/s1 |
| InChIKey | VDWSHFYWUQLIJC-KGLIPLIRSA-N |
| XLogP | 1.66 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |