About 2,3,4,5-tetrachloroaniline
2,3,4,5-tetrachloroaniline (PubChem CID 12466) has the molecular formula C6H3Cl4N
and a molecular weight of 230.91 g/mol. Its IUPAC name is 2,3,4,5-tetrachloroaniline.
Molecular Properties
| Compound Name | 2,3,4,5-tetrachloroaniline |
| PubChem CID | 12466 |
| Molecular Formula | C6H3Cl4N |
| Molecular Weight | 230.91 g/mol |
| Exact Mass | 228.90 |
| IUPAC Name | 2,3,4,5-tetrachloroaniline |
| SMILES | Nc1cc(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6H3Cl4N/c7-2-1-3(11)5(9)6(10)4(2)8/h1H,11H2 |
| InChIKey | GBKZRUCVLTWAML-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.91 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4,5-tetrachloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetrachloroaniline?
The IUPAC name of 2,3,4,5-tetrachloroaniline (CID 12466) is 2,3,4,5-tetrachloroaniline.
What is the SMILES notation for 2,3,4,5-tetrachloroaniline?
The canonical SMILES for 2,3,4,5-tetrachloroaniline is Nc1cc(Cl)c(Cl)c(Cl)c1Cl.
What is the InChIKey of 2,3,4,5-tetrachloroaniline?
The InChIKey is GBKZRUCVLTWAML-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl4N/c7-2-1-3(11)5(9)6(10)4(2)8/h1H,11H2.
What are the key properties of 2,3,4,5-tetrachloroaniline?
2,3,4,5-tetrachloroaniline has a molecular weight of 230.91 g/mol, XLogP of 3.88, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetrachloroaniline is sourced from PubChem (CID 12466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).