C16H14N4O9S — CID 124664033
(5E)-5-[(2-hydroxy-3,5-dinitrophenyl)methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 124664033) has the molecular formula C16H14N4O9S and a molecular weight of 438.37 g/mol. Its IUPAC name is (5E)-5-[(2-hydroxy-3,5-dinitrophenyl)methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2-hydroxy-3,5-dinitrophenyl)methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124664033 |
| Molecular Formula | C16H14N4O9S |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | (5E)-5-[(2-hydroxy-3,5-dinitrophenyl)methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2O)C1=O)N1CCOCC1 |
| InChI | InChI=1S/C16H14N4O9S/c21-13(17-1-3-29-4-2-17)8-18-15(23)12(30-16(18)24)6-9-5-10(19(25)26)7-11(14(9)22)20(27)28/h5-7,22H,1-4,8H2/b12-6+ |
| InChIKey | COGNKZDXYKHPFD-WUXMJOGZSA-N |
| XLogP | 1.10 |
| TPSA | 173.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|