C27H23N3O5S — CID 124664822
2-[(5E)-5-[[4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-phenylacetamide (PubChem CID 124664822) has the molecular formula C27H23N3O5S and a molecular weight of 501.56 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-phenylacetamide.
| Compound Name | 2-[(5E)-5-[[4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 124664822 |
| Molecular Formula | C27H23N3O5S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 2-[(5E)-5-[[4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-phenylacetamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc(/C=C3/SC(=O)N(CC(=O)Nc4ccccc4)C3=O)cc2)c1 |
| InChI | InChI=1S/C27H23N3O5S/c1-18-6-5-9-21(14-18)29-25(32)17-35-22-12-10-19(11-13-22)15-23-26(33)30(27(34)36-23)16-24(31)28-20-7-3-2-4-8-20/h2-15H,16-17H2,1H3,(H,28,31)(H,29,32)/b23-15+ |
| InChIKey | UNZJSVJHOHWRJT-HZHRSRAPSA-N |
| XLogP | 4.69 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|