C24H16Cl2N2O5S — CID 124666128
(5E)-3-[(3,4-dichlorophenyl)methyl]-5-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124666128) has the molecular formula C24H16Cl2N2O5S and a molecular weight of 515.37 g/mol. Its IUPAC name is (5E)-3-[(3,4-dichlorophenyl)methyl]-5-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(3,4-dichlorophenyl)methyl]-5-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124666128 |
| Molecular Formula | C24H16Cl2N2O5S |
| Molecular Weight | 515.37 g/mol |
| Exact Mass | 514.02 |
| IUPAC Name | (5E)-3-[(3,4-dichlorophenyl)methyl]-5-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(OCc3ccc([N+](=O)[O-])cc3)cc2)C(=O)N1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H16Cl2N2O5S/c25-20-10-5-17(11-21(20)26)13-27-23(29)22(34-24(27)30)12-15-3-8-19(9-4-15)33-14-16-1-6-18(7-2-16)28(31)32/h1-12H,13-14H2/b22-12+ |
| InChIKey | ZMZFWAHGHHFCLU-WSDLNYQXSA-N |
| XLogP | 6.72 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.37 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|