C27H22BrClN2O5S — CID 124666887
2-[4-[(E)-[3-[(4-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-(3-chlorophenyl)acetamide (PubChem CID 124666887) has the molecular formula C27H22BrClN2O5S and a molecular weight of 601.91 g/mol. Its IUPAC name is 2-[4-[(E)-[3-[(4-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-[4-[(E)-[3-[(4-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 124666887 |
| Molecular Formula | C27H22BrClN2O5S |
| Molecular Weight | 601.91 g/mol |
| Exact Mass | 600.01 |
| IUPAC Name | 2-[4-[(E)-[3-[(4-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-(3-chlorophenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(Cc3ccc(Br)cc3)C2=O)ccc1OCC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C27H22BrClN2O5S/c1-2-35-23-12-18(8-11-22(23)36-16-25(32)30-21-5-3-4-20(29)14-21)13-24-26(33)31(27(34)37-24)15-17-6-9-19(28)10-7-17/h3-14H,2,15-16H2,1H3,(H,30,32)/b24-13+ |
| InChIKey | BINCMZTWSXUFSC-ZMOGYAJESA-N |
| XLogP | 6.76 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.91 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|