About [(1S)-1,3-dihydrocyclopenta[c]pyran-1-yl]methanamine
[(1S)-1,3-dihydrocyclopenta[c]pyran-1-yl]methanamine (PubChem CID 124668628) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is [(1S)-1,3-dihydrocyclopenta[c]pyran-1-yl]methanamine.
Molecular Properties
| Compound Name | [(1S)-1,3-dihydrocyclopenta[c]pyran-1-yl]methanamine |
| PubChem CID | 124668628 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | [(1S)-1,3-dihydrocyclopenta[c]pyran-1-yl]methanamine |
| SMILES | NC[C@H]1OCC=C2C=CC=C21 |
| InChI | InChI=1S/C9H11NO/c10-6-9-8-3-1-2-7(8)4-5-11-9/h1-4,9H,5-6,10H2/t9-/m1/s1 |
| InChIKey | VHDIPFVOYJJMIX-SECBINFHSA-N |
| XLogP | 0.77 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S)-1,3-dihydrocyclopenta[c]pyran-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1,3-dihydrocyclopenta[c]pyran-1-yl]methanamine?
The IUPAC name of [(1S)-1,3-dihydrocyclopenta[c]pyran-1-yl]methanamine (CID 124668628) is [(1S)-1,3-dihydrocyclopenta[c]pyran-1-yl]methanamine.
What is the SMILES notation for [(1S)-1,3-dihydrocyclopenta[c]pyran-1-yl]methanamine?
The canonical SMILES for [(1S)-1,3-dihydrocyclopenta[c]pyran-1-yl]methanamine is NC[C@H]1OCC=C2C=CC=C21.
What is the InChIKey of [(1S)-1,3-dihydrocyclopenta[c]pyran-1-yl]methanamine?
The InChIKey is VHDIPFVOYJJMIX-SECBINFHSA-N. The full InChI is InChI=1S/C9H11NO/c10-6-9-8-3-1-2-7(8)4-5-11-9/h1-4,9H,5-6,10H2/t9-/m1/s1.
What are the key properties of [(1S)-1,3-dihydrocyclopenta[c]pyran-1-yl]methanamine?
[(1S)-1,3-dihydrocyclopenta[c]pyran-1-yl]methanamine has a molecular weight of 149.19 g/mol, XLogP of 0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1,3-dihydrocyclopenta[c]pyran-1-yl]methanamine is sourced from PubChem (CID 124668628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).