About (5S)-5-(dimethoxymethyl)-3-methyl-4,5-dihydro-1,2-oxazole
(5S)-5-(dimethoxymethyl)-3-methyl-4,5-dihydro-1,2-oxazole (PubChem CID 124668749) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is (5S)-5-(dimethoxymethyl)-3-methyl-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | (5S)-5-(dimethoxymethyl)-3-methyl-4,5-dihydro-1,2-oxazole |
| PubChem CID | 124668749 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (5S)-5-(dimethoxymethyl)-3-methyl-4,5-dihydro-1,2-oxazole |
| SMILES | COC(OC)[C@@H]1CC(C)=NO1 |
| InChI | InChI=1S/C7H13NO3/c1-5-4-6(11-8-5)7(9-2)10-3/h6-7H,4H2,1-3H3/t6-/m0/s1 |
| InChIKey | AKKPBKSORYJDJO-LURJTMIESA-N |
| XLogP | 0.77 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-(dimethoxymethyl)-3-methyl-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(dimethoxymethyl)-3-methyl-4,5-dihydro-1,2-oxazole?
The IUPAC name of (5S)-5-(dimethoxymethyl)-3-methyl-4,5-dihydro-1,2-oxazole (CID 124668749) is (5S)-5-(dimethoxymethyl)-3-methyl-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for (5S)-5-(dimethoxymethyl)-3-methyl-4,5-dihydro-1,2-oxazole?
The canonical SMILES for (5S)-5-(dimethoxymethyl)-3-methyl-4,5-dihydro-1,2-oxazole is COC(OC)[C@@H]1CC(C)=NO1.
What is the InChIKey of (5S)-5-(dimethoxymethyl)-3-methyl-4,5-dihydro-1,2-oxazole?
The InChIKey is AKKPBKSORYJDJO-LURJTMIESA-N. The full InChI is InChI=1S/C7H13NO3/c1-5-4-6(11-8-5)7(9-2)10-3/h6-7H,4H2,1-3H3/t6-/m0/s1.
What are the key properties of (5S)-5-(dimethoxymethyl)-3-methyl-4,5-dihydro-1,2-oxazole?
(5S)-5-(dimethoxymethyl)-3-methyl-4,5-dihydro-1,2-oxazole has a molecular weight of 159.18 g/mol, XLogP of 0.77, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(dimethoxymethyl)-3-methyl-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 124668749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).