C10H7F4N5O3S — CID 124669092
(2R)-2-[2-(4-azido-2,3,5,6-tetrafluorobenzoyl)hydrazinyl]-3-sulfanylpropanoic acid (PubChem CID 124669092) has the molecular formula C10H7F4N5O3S and a molecular weight of 353.26 g/mol. Its IUPAC name is (2R)-2-[2-(4-azido-2,3,5,6-tetrafluorobenzoyl)hydrazinyl]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[2-(4-azido-2,3,5,6-tetrafluorobenzoyl)hydrazinyl]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 124669092 |
| Molecular Formula | C10H7F4N5O3S |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | (2R)-2-[2-(4-azido-2,3,5,6-tetrafluorobenzoyl)hydrazinyl]-3-sulfanylpropanoic acid |
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(C(=O)NN[C@@H](CS)C(=O)O)c(F)c1F |
| InChI | InChI=1S/C10H7F4N5O3S/c11-4-3(9(20)18-16-2(1-23)10(21)22)5(12)7(14)8(6(4)13)17-19-15/h2,16,23H,1H2,(H,18,20)(H,21,22)/t2-/m0/s1 |
| InChIKey | HZHKDFLNEMOXNF-REOHCLBHSA-N |
| XLogP | 1.80 |
| TPSA | 127.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|