C13H18O3 — CID 124669183
(1R)-1-[(1S,2R)-2-(3,5-dimethoxyphenyl)cyclopropyl]ethanol (PubChem CID 124669183) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (1R)-1-[(1S,2R)-2-(3,5-dimethoxyphenyl)cyclopropyl]ethanol.
| Compound Name | (1R)-1-[(1S,2R)-2-(3,5-dimethoxyphenyl)cyclopropyl]ethanol |
|---|---|
| PubChem CID | 124669183 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (1R)-1-[(1S,2R)-2-(3,5-dimethoxyphenyl)cyclopropyl]ethanol |
| SMILES | COc1cc(OC)cc([C@@H]2C[C@@H]2[C@@H](C)O)c1 |
| InChI | InChI=1S/C13H18O3/c1-8(14)12-7-13(12)9-4-10(15-2)6-11(5-9)16-3/h4-6,8,12-14H,7H2,1-3H3/t8-,12-,13+/m1/s1 |
| InChIKey | XIQGGSRGDTUMQB-WQHBLYJGSA-N |
| XLogP | 2.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |