C12H8N4O2S2 — CID 124672035
(5R,6S)-4,7-dioxo-2-sulfanylidene-5-thiophen-2-yl-1,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 124672035) has the molecular formula C12H8N4O2S2 and a molecular weight of 304.36 g/mol. Its IUPAC name is (5R,6S)-4,7-dioxo-2-sulfanylidene-5-thiophen-2-yl-1,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | (5R,6S)-4,7-dioxo-2-sulfanylidene-5-thiophen-2-yl-1,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 124672035 |
| Molecular Formula | C12H8N4O2S2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | (5R,6S)-4,7-dioxo-2-sulfanylidene-5-thiophen-2-yl-1,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | N#C[C@H]1C(=O)Nc2[nH]c(=S)[nH]c(=O)c2[C@@H]1c1cccs1 |
| InChI | InChI=1S/C12H8N4O2S2/c13-4-5-7(6-2-1-3-20-6)8-9(14-10(5)17)15-12(19)16-11(8)18/h1-3,5,7H,(H3,14,15,16,17,18,19)/t5-,7+/m1/s1 |
| InChIKey | OVKIFOJAZYPSMP-VDTYLAMSSA-N |
| XLogP | 1.72 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|