C12H14N2O4 — CID 124673407
ethyl 2-[4-[[(2Z)-2-hydroxyiminoacetyl]amino]phenyl]acetate (PubChem CID 124673407) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is ethyl 2-[4-[[(2Z)-2-hydroxyiminoacetyl]amino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[[(2Z)-2-hydroxyiminoacetyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 124673407 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | ethyl 2-[4-[[(2Z)-2-hydroxyiminoacetyl]amino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(NC(=O)/C=N\O)cc1 |
| InChI | InChI=1S/C12H14N2O4/c1-2-18-12(16)7-9-3-5-10(6-4-9)14-11(15)8-13-17/h3-6,8,17H,2,7H2,1H3,(H,14,15)/b13-8- |
| InChIKey | BBDCFEOYIREZAW-JYRVWZFOSA-N |
| XLogP | 1.19 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|