C16H22N2O — CID 124674116
4,6-dimethyl-N-[(2S)-2-methylbutyl]-1H-indole-2-carboxamide (PubChem CID 124674116) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 4,6-dimethyl-N-[(2S)-2-methylbutyl]-1H-indole-2-carboxamide.
| Compound Name | 4,6-dimethyl-N-[(2S)-2-methylbutyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 124674116 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 4,6-dimethyl-N-[(2S)-2-methylbutyl]-1H-indole-2-carboxamide |
| SMILES | CC[C@H](C)CNC(=O)c1cc2c(C)cc(C)cc2[nH]1 |
| InChI | InChI=1S/C16H22N2O/c1-5-10(2)9-17-16(19)15-8-13-12(4)6-11(3)7-14(13)18-15/h6-8,10,18H,5,9H2,1-4H3,(H,17,19)/t10-/m0/s1 |
| InChIKey | CZWQSZBTNMJOHD-JTQLQIEISA-N |
| XLogP | 3.56 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |