C13H15Cl2NO — CID 124675043
(3R)-3-(2,4-dichlorophenyl)-6-ethoxy-2,3,4,5-tetrahydropyridine (PubChem CID 124675043) has the molecular formula C13H15Cl2NO and a molecular weight of 272.18 g/mol. Its IUPAC name is (3R)-3-(2,4-dichlorophenyl)-6-ethoxy-2,3,4,5-tetrahydropyridine.
| Compound Name | (3R)-3-(2,4-dichlorophenyl)-6-ethoxy-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 124675043 |
| Molecular Formula | C13H15Cl2NO |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | (3R)-3-(2,4-dichlorophenyl)-6-ethoxy-2,3,4,5-tetrahydropyridine |
| SMILES | CCOC1=NC[C@@H](c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C13H15Cl2NO/c1-2-17-13-6-3-9(8-16-13)11-5-4-10(14)7-12(11)15/h4-5,7,9H,2-3,6,8H2,1H3/t9-/m0/s1 |
| InChIKey | ZVJOTIMXPCDLRP-VIFPVBQESA-N |
| XLogP | 4.31 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |