About [(4R)-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol
[(4R)-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol (PubChem CID 124676721) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is [(4R)-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol.
Molecular Properties
| Compound Name | [(4R)-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol |
| PubChem CID | 124676721 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | [(4R)-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol |
| SMILES | Cn1cc2c(n1)CC[C@H]2CO |
| InChI | InChI=1S/C8H12N2O/c1-10-4-7-6(5-11)2-3-8(7)9-10/h4,6,11H,2-3,5H2,1H3/t6-/m0/s1 |
| InChIKey | IXMWLFLNNYRYNU-LURJTMIESA-N |
| XLogP | 0.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(4R)-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol?
The IUPAC name of [(4R)-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol (CID 124676721) is [(4R)-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol.
What is the SMILES notation for [(4R)-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol?
The canonical SMILES for [(4R)-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol is Cn1cc2c(n1)CC[C@H]2CO.
What is the InChIKey of [(4R)-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol?
The InChIKey is IXMWLFLNNYRYNU-LURJTMIESA-N. The full InChI is InChI=1S/C8H12N2O/c1-10-4-7-6(5-11)2-3-8(7)9-10/h4,6,11H,2-3,5H2,1H3/t6-/m0/s1.
What are the key properties of [(4R)-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol?
[(4R)-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol has a molecular weight of 152.20 g/mol, XLogP of 0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol is sourced from PubChem (CID 124676721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).