About ethyl (1S,2R)-1,5-dioxothiane-2-carboxylate
ethyl (1S,2R)-1,5-dioxothiane-2-carboxylate (PubChem CID 124676770) has the molecular formula C8H12O4S
and a molecular weight of 204.25 g/mol. Its IUPAC name is ethyl (1S,2R)-1,5-dioxothiane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl (1S,2R)-1,5-dioxothiane-2-carboxylate |
| PubChem CID | 124676770 |
| Molecular Formula | C8H12O4S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | ethyl (1S,2R)-1,5-dioxothiane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC(=O)C[S@@]1=O |
| InChI | InChI=1S/C8H12O4S/c1-2-12-8(10)7-4-3-6(9)5-13(7)11/h7H,2-5H2,1H3/t7-,13+/m1/s1 |
| InChIKey | VQZDVZCYJPNRTE-UHLUBPPHSA-N |
| XLogP | 0.03 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (1S,2R)-1,5-dioxothiane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (1S,2R)-1,5-dioxothiane-2-carboxylate?
The IUPAC name of ethyl (1S,2R)-1,5-dioxothiane-2-carboxylate (CID 124676770) is ethyl (1S,2R)-1,5-dioxothiane-2-carboxylate.
What is the SMILES notation for ethyl (1S,2R)-1,5-dioxothiane-2-carboxylate?
The canonical SMILES for ethyl (1S,2R)-1,5-dioxothiane-2-carboxylate is CCOC(=O)[C@H]1CCC(=O)C[S@@]1=O.
What is the InChIKey of ethyl (1S,2R)-1,5-dioxothiane-2-carboxylate?
The InChIKey is VQZDVZCYJPNRTE-UHLUBPPHSA-N. The full InChI is InChI=1S/C8H12O4S/c1-2-12-8(10)7-4-3-6(9)5-13(7)11/h7H,2-5H2,1H3/t7-,13+/m1/s1.
What are the key properties of ethyl (1S,2R)-1,5-dioxothiane-2-carboxylate?
ethyl (1S,2R)-1,5-dioxothiane-2-carboxylate has a molecular weight of 204.25 g/mol, XLogP of 0.03, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (1S,2R)-1,5-dioxothiane-2-carboxylate is sourced from PubChem (CID 124676770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).