C14H20N2O — CID 124678191
(4aR,9S,11aS)-9-methyl-1,2,3,4,4a,8,9,10,11,11a-decahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 124678191) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is (4aR,9S,11aS)-9-methyl-1,2,3,4,4a,8,9,10,11,11a-decahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (4aR,9S,11aS)-9-methyl-1,2,3,4,4a,8,9,10,11,11a-decahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 124678191 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (4aR,9S,11aS)-9-methyl-1,2,3,4,4a,8,9,10,11,11a-decahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | C[C@@H]1CC(=O)C2=C(C1)N[C@H]1CCCC[C@H]1N=C2 |
| InChI | InChI=1S/C14H20N2O/c1-9-6-13-10(14(17)7-9)8-15-11-4-2-3-5-12(11)16-13/h8-9,11-12,16H,2-7H2,1H3/t9-,11+,12-/m0/s1 |
| InChIKey | AJNXQRAELOAUAL-WCQGTBRESA-N |
| XLogP | 2.22 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |