C9H13NO2 — CID 124679495
(9aR)-4,6,7,8,9,9a-hexahydroquinolizine-1,3-dione (PubChem CID 124679495) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is (9aR)-4,6,7,8,9,9a-hexahydroquinolizine-1,3-dione.
| Compound Name | (9aR)-4,6,7,8,9,9a-hexahydroquinolizine-1,3-dione |
|---|---|
| PubChem CID | 124679495 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | (9aR)-4,6,7,8,9,9a-hexahydroquinolizine-1,3-dione |
| SMILES | O=C1CC(=O)[C@H]2CCCCN2C1 |
| InChI | InChI=1S/C9H13NO2/c11-7-5-9(12)8-3-1-2-4-10(8)6-7/h8H,1-6H2/t8-/m1/s1 |
| InChIKey | YIPDZGXSYWVDBC-MRVPVSSYSA-N |
| XLogP | 0.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|