C18H21N5O2 — CID 124680038
4-[2-[(R)-cyclopropyl(hydroxy)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-2-methoxypyridine-3-carbonitrile (PubChem CID 124680038) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-[2-[(R)-cyclopropyl(hydroxy)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-2-methoxypyridine-3-carbonitrile.
| Compound Name | 4-[2-[(R)-cyclopropyl(hydroxy)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-2-methoxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 124680038 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 4-[2-[(R)-cyclopropyl(hydroxy)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-2-methoxypyridine-3-carbonitrile |
| SMILES | COc1nccc(N2CCCn3nc([C@H](O)C4CC4)cc3C2)c1C#N |
| InChI | InChI=1S/C18H21N5O2/c1-25-18-14(10-19)16(5-6-20-18)22-7-2-8-23-13(11-22)9-15(21-23)17(24)12-3-4-12/h5-6,9,12,17,24H,2-4,7-8,11H2,1H3/t17-/m1/s1 |
| InChIKey | XLGFGXWVUGDXAM-QGZVFWFLSA-N |
| XLogP | 2.01 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |