About (1S,5R)-spiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one
(1S,5R)-spiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one (PubChem CID 124680733) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is (1S,5R)-spiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one.
Molecular Properties
| Compound Name | (1S,5R)-spiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one |
| PubChem CID | 124680733 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (1S,5R)-spiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one |
| SMILES | O=C1COC2(CN1)C[C@H]1CC[C@@H](C2)N1 |
| InChI | InChI=1S/C10H16N2O2/c13-9-5-14-10(6-11-9)3-7-1-2-8(4-10)12-7/h7-8,12H,1-6H2,(H,11,13)/t7-,8+,10? |
| InChIKey | NXORNAWFKAZFOV-JWHQNHQBSA-N |
| XLogP | -0.21 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S,5R)-spiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-spiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one?
The IUPAC name of (1S,5R)-spiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one (CID 124680733) is (1S,5R)-spiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one.
What is the SMILES notation for (1S,5R)-spiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one?
The canonical SMILES for (1S,5R)-spiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one is O=C1COC2(CN1)C[C@H]1CC[C@@H](C2)N1.
What is the InChIKey of (1S,5R)-spiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one?
The InChIKey is NXORNAWFKAZFOV-JWHQNHQBSA-N. The full InChI is InChI=1S/C10H16N2O2/c13-9-5-14-10(6-11-9)3-7-1-2-8(4-10)12-7/h7-8,12H,1-6H2,(H,11,13)/t7-,8+,10?.
What are the key properties of (1S,5R)-spiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one?
(1S,5R)-spiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one has a molecular weight of 196.25 g/mol, XLogP of -0.21, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-spiro[8-azabicyclo[3.2.1]octane-3,6'-morpholine]-3'-one is sourced from PubChem (CID 124680733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).