About (7R)-7-(2,5-difluorophenyl)-1,4-thiazepan-5-one
(7R)-7-(2,5-difluorophenyl)-1,4-thiazepan-5-one (PubChem CID 124680747) has the molecular formula C11H11F2NOS
and a molecular weight of 243.28 g/mol. Its IUPAC name is (7R)-7-(2,5-difluorophenyl)-1,4-thiazepan-5-one.
Molecular Properties
| Compound Name | (7R)-7-(2,5-difluorophenyl)-1,4-thiazepan-5-one |
| PubChem CID | 124680747 |
| Molecular Formula | C11H11F2NOS |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | (7R)-7-(2,5-difluorophenyl)-1,4-thiazepan-5-one |
| SMILES | O=C1C[C@H](c2cc(F)ccc2F)SCCN1 |
| InChI | InChI=1S/C11H11F2NOS/c12-7-1-2-9(13)8(5-7)10-6-11(15)14-3-4-16-10/h1-2,5,10H,3-4,6H2,(H,14,15)/t10-/m1/s1 |
| InChIKey | XYRHVWMMLIQAFA-SNVBAGLBSA-N |
| XLogP | 2.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7R)-7-(2,5-difluorophenyl)-1,4-thiazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-7-(2,5-difluorophenyl)-1,4-thiazepan-5-one?
The IUPAC name of (7R)-7-(2,5-difluorophenyl)-1,4-thiazepan-5-one (CID 124680747) is (7R)-7-(2,5-difluorophenyl)-1,4-thiazepan-5-one.
What is the SMILES notation for (7R)-7-(2,5-difluorophenyl)-1,4-thiazepan-5-one?
The canonical SMILES for (7R)-7-(2,5-difluorophenyl)-1,4-thiazepan-5-one is O=C1C[C@H](c2cc(F)ccc2F)SCCN1.
What is the InChIKey of (7R)-7-(2,5-difluorophenyl)-1,4-thiazepan-5-one?
The InChIKey is XYRHVWMMLIQAFA-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H11F2NOS/c12-7-1-2-9(13)8(5-7)10-6-11(15)14-3-4-16-10/h1-2,5,10H,3-4,6H2,(H,14,15)/t10-/m1/s1.
What are the key properties of (7R)-7-(2,5-difluorophenyl)-1,4-thiazepan-5-one?
(7R)-7-(2,5-difluorophenyl)-1,4-thiazepan-5-one has a molecular weight of 243.28 g/mol, XLogP of 2.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-7-(2,5-difluorophenyl)-1,4-thiazepan-5-one is sourced from PubChem (CID 124680747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).