C10H11NO3S — CID 124680761
2-[(3R)-thiolan-3-yl]oxypyridine-3-carboxylic acid (PubChem CID 124680761) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is 2-[(3R)-thiolan-3-yl]oxypyridine-3-carboxylic acid.
| Compound Name | 2-[(3R)-thiolan-3-yl]oxypyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 124680761 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 2-[(3R)-thiolan-3-yl]oxypyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1O[C@@H]1CCSC1 |
| InChI | InChI=1S/C10H11NO3S/c12-10(13)8-2-1-4-11-9(8)14-7-3-5-15-6-7/h1-2,4,7H,3,5-6H2,(H,12,13)/t7-/m1/s1 |
| InChIKey | DAZAKQCNUAFPFL-SSDOTTSWSA-N |
| XLogP | 1.66 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |