C14H16N2O4 — CID 124680961
N-[(3R)-hex-1-yn-3-yl]-3-methoxy-4-nitrobenzamide (PubChem CID 124680961) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is N-[(3R)-hex-1-yn-3-yl]-3-methoxy-4-nitrobenzamide.
| Compound Name | N-[(3R)-hex-1-yn-3-yl]-3-methoxy-4-nitrobenzamide |
|---|---|
| PubChem CID | 124680961 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-[(3R)-hex-1-yn-3-yl]-3-methoxy-4-nitrobenzamide |
| SMILES | C#C[C@@H](CCC)NC(=O)c1ccc([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C14H16N2O4/c1-4-6-11(5-2)15-14(17)10-7-8-12(16(18)19)13(9-10)20-3/h2,7-9,11H,4,6H2,1,3H3,(H,15,17)/t11-/m0/s1 |
| InChIKey | PEBIEGOUUIBJNF-NSHDSACASA-N |
| XLogP | 2.14 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|