C10H16N4O — CID 124681117
(5R,6R)-5-amino-6-(1-ethylpyrazol-4-yl)piperidin-2-one (PubChem CID 124681117) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is (5R,6R)-5-amino-6-(1-ethylpyrazol-4-yl)piperidin-2-one.
| Compound Name | (5R,6R)-5-amino-6-(1-ethylpyrazol-4-yl)piperidin-2-one |
|---|---|
| PubChem CID | 124681117 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | (5R,6R)-5-amino-6-(1-ethylpyrazol-4-yl)piperidin-2-one |
| SMILES | CCn1cc([C@H]2NC(=O)CC[C@H]2N)cn1 |
| InChI | InChI=1S/C10H16N4O/c1-2-14-6-7(5-12-14)10-8(11)3-4-9(15)13-10/h5-6,8,10H,2-4,11H2,1H3,(H,13,15)/t8-,10-/m1/s1 |
| InChIKey | SIAGUQYTBGASAB-PSASIEDQSA-N |
| XLogP | 0.18 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |