C10H12BrNO3 — CID 124681142
(2S)-2-(2-bromo-5-methoxyphenyl)-2-(methylamino)acetic acid (PubChem CID 124681142) has the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. Its IUPAC name is (2S)-2-(2-bromo-5-methoxyphenyl)-2-(methylamino)acetic acid.
| Compound Name | (2S)-2-(2-bromo-5-methoxyphenyl)-2-(methylamino)acetic acid |
|---|---|
| PubChem CID | 124681142 |
| Molecular Formula | C10H12BrNO3 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | (2S)-2-(2-bromo-5-methoxyphenyl)-2-(methylamino)acetic acid |
| SMILES | CN[C@H](C(=O)O)c1cc(OC)ccc1Br |
| InChI | InChI=1S/C10H12BrNO3/c1-12-9(10(13)14)7-5-6(15-2)3-4-8(7)11/h3-5,9,12H,1-2H3,(H,13,14)/t9-/m0/s1 |
| InChIKey | FSKRWWSQMTVCPX-VIFPVBQESA-N |
| XLogP | 1.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |