About (3R,4R)-1-(2-fluorophenyl)sulfonyl-3,4-dimethoxypyrrolidine
(3R,4R)-1-(2-fluorophenyl)sulfonyl-3,4-dimethoxypyrrolidine (PubChem CID 124681199) has the molecular formula C12H16FNO4S
and a molecular weight of 289.33 g/mol. Its IUPAC name is (3R,4R)-1-(2-fluorophenyl)sulfonyl-3,4-dimethoxypyrrolidine.
Molecular Properties
| Compound Name | (3R,4R)-1-(2-fluorophenyl)sulfonyl-3,4-dimethoxypyrrolidine |
| PubChem CID | 124681199 |
| Molecular Formula | C12H16FNO4S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | (3R,4R)-1-(2-fluorophenyl)sulfonyl-3,4-dimethoxypyrrolidine |
| SMILES | CO[C@@H]1CN(S(=O)(=O)c2ccccc2F)C[C@H]1OC |
| InChI | InChI=1S/C12H16FNO4S/c1-17-10-7-14(8-11(10)18-2)19(15,16)12-6-4-3-5-9(12)13/h3-6,10-11H,7-8H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | ZSBYGIHSLQRFLQ-GHMZBOCLSA-N |
| XLogP | 0.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R,4R)-1-(2-fluorophenyl)sulfonyl-3,4-dimethoxypyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-1-(2-fluorophenyl)sulfonyl-3,4-dimethoxypyrrolidine?
The IUPAC name of (3R,4R)-1-(2-fluorophenyl)sulfonyl-3,4-dimethoxypyrrolidine (CID 124681199) is (3R,4R)-1-(2-fluorophenyl)sulfonyl-3,4-dimethoxypyrrolidine.
What is the SMILES notation for (3R,4R)-1-(2-fluorophenyl)sulfonyl-3,4-dimethoxypyrrolidine?
The canonical SMILES for (3R,4R)-1-(2-fluorophenyl)sulfonyl-3,4-dimethoxypyrrolidine is CO[C@@H]1CN(S(=O)(=O)c2ccccc2F)C[C@H]1OC.
What is the InChIKey of (3R,4R)-1-(2-fluorophenyl)sulfonyl-3,4-dimethoxypyrrolidine?
The InChIKey is ZSBYGIHSLQRFLQ-GHMZBOCLSA-N. The full InChI is InChI=1S/C12H16FNO4S/c1-17-10-7-14(8-11(10)18-2)19(15,16)12-6-4-3-5-9(12)13/h3-6,10-11H,7-8H2,1-2H3/t10-,11-/m1/s1.
What are the key properties of (3R,4R)-1-(2-fluorophenyl)sulfonyl-3,4-dimethoxypyrrolidine?
(3R,4R)-1-(2-fluorophenyl)sulfonyl-3,4-dimethoxypyrrolidine has a molecular weight of 289.33 g/mol, XLogP of 0.86, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-1-(2-fluorophenyl)sulfonyl-3,4-dimethoxypyrrolidine is sourced from PubChem (CID 124681199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).