C18H26N2O4 — CID 124681649
(2R)-2-[[2-[(2S)-4-benzylmorpholin-2-yl]acetyl]amino]-3-methylbutanoic acid (PubChem CID 124681649) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is (2R)-2-[[2-[(2S)-4-benzylmorpholin-2-yl]acetyl]amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[2-[(2S)-4-benzylmorpholin-2-yl]acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 124681649 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (2R)-2-[[2-[(2S)-4-benzylmorpholin-2-yl]acetyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)C[C@H]1CN(Cc2ccccc2)CCO1)C(=O)O |
| InChI | InChI=1S/C18H26N2O4/c1-13(2)17(18(22)23)19-16(21)10-15-12-20(8-9-24-15)11-14-6-4-3-5-7-14/h3-7,13,15,17H,8-12H2,1-2H3,(H,19,21)(H,22,23)/t15-,17+/m0/s1 |
| InChIKey | MXNIKPHZPHNHRZ-DOTOQJQBSA-N |
| XLogP | 1.50 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |