C15H21N3O4 — CID 124683832
3-[(2R)-1-(1-ethyl-6-oxopyridazine-3-carbonyl)piperidin-2-yl]propanoic acid (PubChem CID 124683832) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-[(2R)-1-(1-ethyl-6-oxopyridazine-3-carbonyl)piperidin-2-yl]propanoic acid.
| Compound Name | 3-[(2R)-1-(1-ethyl-6-oxopyridazine-3-carbonyl)piperidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 124683832 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3-[(2R)-1-(1-ethyl-6-oxopyridazine-3-carbonyl)piperidin-2-yl]propanoic acid |
| SMILES | CCn1nc(C(=O)N2CCCC[C@@H]2CCC(=O)O)ccc1=O |
| InChI | InChI=1S/C15H21N3O4/c1-2-18-13(19)8-7-12(16-18)15(22)17-10-4-3-5-11(17)6-9-14(20)21/h7-8,11H,2-6,9-10H2,1H3,(H,20,21)/t11-/m1/s1 |
| InChIKey | PTUADXSDYCEZMS-LLVKDONJSA-N |
| XLogP | 1.12 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |