C17H23NO4 — CID 124686007
(3R)-1-[(3S)-3-(4-methoxyphenyl)butanoyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 124686007) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (3R)-1-[(3S)-3-(4-methoxyphenyl)butanoyl]-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-1-[(3S)-3-(4-methoxyphenyl)butanoyl]-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 124686007 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (3R)-1-[(3S)-3-(4-methoxyphenyl)butanoyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | COc1ccc([C@@H](C)CC(=O)N2CC[C@@](C)(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C17H23NO4/c1-12(13-4-6-14(22-3)7-5-13)10-15(19)18-9-8-17(2,11-18)16(20)21/h4-7,12H,8-11H2,1-3H3,(H,20,21)/t12-,17+/m0/s1 |
| InChIKey | PETHZHPYRJQMOP-YVEFUNNKSA-N |
| XLogP | 2.51 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |