About [(1S,3R)-3-aminocyclohexyl]-[(2S)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone
[(1S,3R)-3-aminocyclohexyl]-[(2S)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone (PubChem CID 124686929) has the molecular formula C18H26N2O2
and a molecular weight of 302.42 g/mol. Its IUPAC name is [(1S,3R)-3-aminocyclohexyl]-[(2S)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone.
Molecular Properties
| Compound Name | [(1S,3R)-3-aminocyclohexyl]-[(2S)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone |
| PubChem CID | 124686929 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | [(1S,3R)-3-aminocyclohexyl]-[(2S)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone |
| SMILES | COc1ccccc1[C@@H]1CCCN1C(=O)[C@H]1CCC[C@@H](N)C1 |
| InChI | InChI=1S/C18H26N2O2/c1-22-17-10-3-2-8-15(17)16-9-5-11-20(16)18(21)13-6-4-7-14(19)12-13/h2-3,8,10,13-14,16H,4-7,9,11-12,19H2,1H3/t13-,14+,16-/m0/s1 |
| InChIKey | JMTGVUYXOWVDHE-LZWOXQAQSA-N |
| XLogP | 2.88 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S,3R)-3-aminocyclohexyl]-[(2S)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3R)-3-aminocyclohexyl]-[(2S)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone?
The IUPAC name of [(1S,3R)-3-aminocyclohexyl]-[(2S)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone (CID 124686929) is [(1S,3R)-3-aminocyclohexyl]-[(2S)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone.
What is the SMILES notation for [(1S,3R)-3-aminocyclohexyl]-[(2S)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone?
The canonical SMILES for [(1S,3R)-3-aminocyclohexyl]-[(2S)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone is COc1ccccc1[C@@H]1CCCN1C(=O)[C@H]1CCC[C@@H](N)C1.
What is the InChIKey of [(1S,3R)-3-aminocyclohexyl]-[(2S)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone?
The InChIKey is JMTGVUYXOWVDHE-LZWOXQAQSA-N. The full InChI is InChI=1S/C18H26N2O2/c1-22-17-10-3-2-8-15(17)16-9-5-11-20(16)18(21)13-6-4-7-14(19)12-13/h2-3,8,10,13-14,16H,4-7,9,11-12,19H2,1H3/t13-,14+,16-/m0/s1.
What are the key properties of [(1S,3R)-3-aminocyclohexyl]-[(2S)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone?
[(1S,3R)-3-aminocyclohexyl]-[(2S)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone has a molecular weight of 302.42 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3R)-3-aminocyclohexyl]-[(2S)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone is sourced from PubChem (CID 124686929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).