C18H20N2O3 — CID 124687466
(3R)-N-[4-(3-methoxyphenoxy)phenyl]pyrrolidine-3-carboxamide (PubChem CID 124687466) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (3R)-N-[4-(3-methoxyphenoxy)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[4-(3-methoxyphenoxy)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 124687466 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (3R)-N-[4-(3-methoxyphenoxy)phenyl]pyrrolidine-3-carboxamide |
| SMILES | COc1cccc(Oc2ccc(NC(=O)[C@@H]3CCNC3)cc2)c1 |
| InChI | InChI=1S/C18H20N2O3/c1-22-16-3-2-4-17(11-16)23-15-7-5-14(6-8-15)20-18(21)13-9-10-19-12-13/h2-8,11,13,19H,9-10,12H2,1H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | MUKXKYAHPFVQNE-CYBMUJFWSA-N |
| XLogP | 3.04 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |