C17H26N2O4S — CID 124689221
1-[(2R,4R)-4-amino-2-methylpiperidin-1-yl]-4-(4-methylsulfonylphenoxy)butan-1-one (PubChem CID 124689221) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is 1-[(2R,4R)-4-amino-2-methylpiperidin-1-yl]-4-(4-methylsulfonylphenoxy)butan-1-one.
| Compound Name | 1-[(2R,4R)-4-amino-2-methylpiperidin-1-yl]-4-(4-methylsulfonylphenoxy)butan-1-one |
|---|---|
| PubChem CID | 124689221 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-[(2R,4R)-4-amino-2-methylpiperidin-1-yl]-4-(4-methylsulfonylphenoxy)butan-1-one |
| SMILES | C[C@@H]1C[C@H](N)CCN1C(=O)CCCOc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H26N2O4S/c1-13-12-14(18)9-10-19(13)17(20)4-3-11-23-15-5-7-16(8-6-15)24(2,21)22/h5-8,13-14H,3-4,9-12,18H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | VWSSZVUTHMNOBD-ZIAGYGMSSA-N |
| XLogP | 1.59 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|