C17H22FNO3 — CID 124690812
3-[(2R)-1-[(2R)-2-(2-fluorophenyl)propanoyl]piperidin-2-yl]propanoic acid (PubChem CID 124690812) has the molecular formula C17H22FNO3 and a molecular weight of 307.36 g/mol. Its IUPAC name is 3-[(2R)-1-[(2R)-2-(2-fluorophenyl)propanoyl]piperidin-2-yl]propanoic acid.
| Compound Name | 3-[(2R)-1-[(2R)-2-(2-fluorophenyl)propanoyl]piperidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 124690812 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 3-[(2R)-1-[(2R)-2-(2-fluorophenyl)propanoyl]piperidin-2-yl]propanoic acid |
| SMILES | C[C@@H](C(=O)N1CCCC[C@@H]1CCC(=O)O)c1ccccc1F |
| InChI | InChI=1S/C17H22FNO3/c1-12(14-7-2-3-8-15(14)18)17(22)19-11-5-4-6-13(19)9-10-16(20)21/h2-3,7-8,12-13H,4-6,9-11H2,1H3,(H,20,21)/t12-,13-/m1/s1 |
| InChIKey | MHPAFERZBDXATF-CHWSQXEVSA-N |
| XLogP | 3.18 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |