About 2-(4-nitrophenyl)-N-(1,2-oxazol-3-yl)acetamide
2-(4-nitrophenyl)-N-(1,2-oxazol-3-yl)acetamide (PubChem CID 1246930) has the molecular formula C11H9N3O4
and a molecular weight of 247.21 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-N-(1,2-oxazol-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-(4-nitrophenyl)-N-(1,2-oxazol-3-yl)acetamide |
| PubChem CID | 1246930 |
| Molecular Formula | C11H9N3O4 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-(4-nitrophenyl)-N-(1,2-oxazol-3-yl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1ccon1 |
| InChI | InChI=1S/C11H9N3O4/c15-11(12-10-5-6-18-13-10)7-8-1-3-9(4-2-8)14(16)17/h1-6H,7H2,(H,12,13,15) |
| InChIKey | IQXCLFHHXKFJRJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenyl)-N-(1,2-oxazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenyl)-N-(1,2-oxazol-3-yl)acetamide?
The IUPAC name of 2-(4-nitrophenyl)-N-(1,2-oxazol-3-yl)acetamide (CID 1246930) is 2-(4-nitrophenyl)-N-(1,2-oxazol-3-yl)acetamide.
What is the SMILES notation for 2-(4-nitrophenyl)-N-(1,2-oxazol-3-yl)acetamide?
The canonical SMILES for 2-(4-nitrophenyl)-N-(1,2-oxazol-3-yl)acetamide is O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1ccon1.
What is the InChIKey of 2-(4-nitrophenyl)-N-(1,2-oxazol-3-yl)acetamide?
The InChIKey is IQXCLFHHXKFJRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O4/c15-11(12-10-5-6-18-13-10)7-8-1-3-9(4-2-8)14(16)17/h1-6H,7H2,(H,12,13,15).
What are the key properties of 2-(4-nitrophenyl)-N-(1,2-oxazol-3-yl)acetamide?
2-(4-nitrophenyl)-N-(1,2-oxazol-3-yl)acetamide has a molecular weight of 247.21 g/mol, XLogP of 1.76, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenyl)-N-(1,2-oxazol-3-yl)acetamide is sourced from PubChem (CID 1246930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).