C21H26N2O2 — CID 124693951
1-[(2S,4R)-4-amino-2-methylpiperidin-1-yl]-2-(2-benzylphenoxy)ethanone (PubChem CID 124693951) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-[(2S,4R)-4-amino-2-methylpiperidin-1-yl]-2-(2-benzylphenoxy)ethanone.
| Compound Name | 1-[(2S,4R)-4-amino-2-methylpiperidin-1-yl]-2-(2-benzylphenoxy)ethanone |
|---|---|
| PubChem CID | 124693951 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-[(2S,4R)-4-amino-2-methylpiperidin-1-yl]-2-(2-benzylphenoxy)ethanone |
| SMILES | C[C@H]1C[C@H](N)CCN1C(=O)COc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C21H26N2O2/c1-16-13-19(22)11-12-23(16)21(24)15-25-20-10-6-5-9-18(20)14-17-7-3-2-4-8-17/h2-10,16,19H,11-15,22H2,1H3/t16-,19+/m0/s1 |
| InChIKey | OUJARYASVCKSSQ-QFBILLFUSA-N |
| XLogP | 2.99 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |