About 1-[2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]piperazin-2-one
1-[2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]piperazin-2-one (PubChem CID 124693974) has the molecular formula C12H21N3O3
and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-[2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]piperazin-2-one.
Molecular Properties
| Compound Name | 1-[2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]piperazin-2-one |
| PubChem CID | 124693974 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1-[2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]piperazin-2-one |
| SMILES | C[C@@H]1CO[C@@H](C)CN1C(=O)CN1CCNCC1=O |
| InChI | InChI=1S/C12H21N3O3/c1-9-8-18-10(2)6-15(9)12(17)7-14-4-3-13-5-11(14)16/h9-10,13H,3-8H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | UTTVMXZEEUPDSR-ZJUUUORDSA-N |
| XLogP | -0.95 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]piperazin-2-one?
The IUPAC name of 1-[2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]piperazin-2-one (CID 124693974) is 1-[2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]piperazin-2-one.
What is the SMILES notation for 1-[2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]piperazin-2-one?
The canonical SMILES for 1-[2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]piperazin-2-one is C[C@@H]1CO[C@@H](C)CN1C(=O)CN1CCNCC1=O.
What is the InChIKey of 1-[2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]piperazin-2-one?
The InChIKey is UTTVMXZEEUPDSR-ZJUUUORDSA-N. The full InChI is InChI=1S/C12H21N3O3/c1-9-8-18-10(2)6-15(9)12(17)7-14-4-3-13-5-11(14)16/h9-10,13H,3-8H2,1-2H3/t9-,10+/m1/s1.
What are the key properties of 1-[2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]piperazin-2-one?
1-[2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]piperazin-2-one has a molecular weight of 255.32 g/mol, XLogP of -0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(2S,5R)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]piperazin-2-one is sourced from PubChem (CID 124693974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).