C16H18N2O4 — CID 124694565
(2R)-4-(4,6-dimethyl-1H-indole-2-carbonyl)morpholine-2-carboxylic acid (PubChem CID 124694565) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2R)-4-(4,6-dimethyl-1H-indole-2-carbonyl)morpholine-2-carboxylic acid.
| Compound Name | (2R)-4-(4,6-dimethyl-1H-indole-2-carbonyl)morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 124694565 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (2R)-4-(4,6-dimethyl-1H-indole-2-carbonyl)morpholine-2-carboxylic acid |
| SMILES | Cc1cc(C)c2cc(C(=O)N3CCO[C@@H](C(=O)O)C3)[nH]c2c1 |
| InChI | InChI=1S/C16H18N2O4/c1-9-5-10(2)11-7-13(17-12(11)6-9)15(19)18-3-4-22-14(8-18)16(20)21/h5-7,14,17H,3-4,8H2,1-2H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | PKFVPVAEBOMXMV-CQSZACIVSA-N |
| XLogP | 1.71 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |