C15H21N3O2 — CID 124696949
4-[(2R,3S)-2-(aminomethyl)-3-methylpiperidine-1-carbonyl]benzamide (PubChem CID 124696949) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-[(2R,3S)-2-(aminomethyl)-3-methylpiperidine-1-carbonyl]benzamide.
| Compound Name | 4-[(2R,3S)-2-(aminomethyl)-3-methylpiperidine-1-carbonyl]benzamide |
|---|---|
| PubChem CID | 124696949 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 4-[(2R,3S)-2-(aminomethyl)-3-methylpiperidine-1-carbonyl]benzamide |
| SMILES | C[C@H]1CCCN(C(=O)c2ccc(C(N)=O)cc2)[C@H]1CN |
| InChI | InChI=1S/C15H21N3O2/c1-10-3-2-8-18(13(10)9-16)15(20)12-6-4-11(5-7-12)14(17)19/h4-7,10,13H,2-3,8-9,16H2,1H3,(H2,17,19)/t10-,13-/m0/s1 |
| InChIKey | OMJVHMZKEPXLRS-GWCFXTLKSA-N |
| XLogP | 0.98 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |