About 1-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-4-phenylpiperidine-4-carboxylic acid
1-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-4-phenylpiperidine-4-carboxylic acid (PubChem CID 124697170) has the molecular formula C20H22ClN3O3
and a molecular weight of 387.87 g/mol. Its IUPAC name is 1-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-4-phenylpiperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-4-phenylpiperidine-4-carboxylic acid |
| PubChem CID | 124697170 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-4-phenylpiperidine-4-carboxylic acid |
| SMILES | Cc1nn(C)c(Cl)c1/C=C/C(=O)N1CCC(C(=O)O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H22ClN3O3/c1-14-16(18(21)23(2)22-14)8-9-17(25)24-12-10-20(11-13-24,19(26)27)15-6-4-3-5-7-15/h3-9H,10-13H2,1-2H3,(H,26,27)/b9-8+ |
| InChIKey | WDWAAWWMHSQERA-CMDGGOBGSA-N |
| XLogP | 3.04 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-4-phenylpiperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-4-phenylpiperidine-4-carboxylic acid?
The IUPAC name of 1-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-4-phenylpiperidine-4-carboxylic acid (CID 124697170) is 1-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-4-phenylpiperidine-4-carboxylic acid.
What is the SMILES notation for 1-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-4-phenylpiperidine-4-carboxylic acid?
The canonical SMILES for 1-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-4-phenylpiperidine-4-carboxylic acid is Cc1nn(C)c(Cl)c1/C=C/C(=O)N1CCC(C(=O)O)(c2ccccc2)CC1.
What is the InChIKey of 1-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-4-phenylpiperidine-4-carboxylic acid?
The InChIKey is WDWAAWWMHSQERA-CMDGGOBGSA-N. The full InChI is InChI=1S/C20H22ClN3O3/c1-14-16(18(21)23(2)22-14)8-9-17(25)24-12-10-20(11-13-24,19(26)27)15-6-4-3-5-7-15/h3-9H,10-13H2,1-2H3,(H,26,27)/b9-8+.
What are the key properties of 1-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-4-phenylpiperidine-4-carboxylic acid?
1-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-4-phenylpiperidine-4-carboxylic acid has a molecular weight of 387.87 g/mol, XLogP of 3.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]-4-phenylpiperidine-4-carboxylic acid is sourced from PubChem (CID 124697170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).