C15H19FN4O2 — CID 124697386
(2S)-N-[2-(5-fluoro-1-methylbenzimidazol-2-yl)ethyl]morpholine-2-carboxamide (PubChem CID 124697386) has the molecular formula C15H19FN4O2 and a molecular weight of 306.34 g/mol. Its IUPAC name is (2S)-N-[2-(5-fluoro-1-methylbenzimidazol-2-yl)ethyl]morpholine-2-carboxamide.
| Compound Name | (2S)-N-[2-(5-fluoro-1-methylbenzimidazol-2-yl)ethyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 124697386 |
| Molecular Formula | C15H19FN4O2 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (2S)-N-[2-(5-fluoro-1-methylbenzimidazol-2-yl)ethyl]morpholine-2-carboxamide |
| SMILES | Cn1c(CCNC(=O)[C@@H]2CNCCO2)nc2cc(F)ccc21 |
| InChI | InChI=1S/C15H19FN4O2/c1-20-12-3-2-10(16)8-11(12)19-14(20)4-5-18-15(21)13-9-17-6-7-22-13/h2-3,8,13,17H,4-7,9H2,1H3,(H,18,21)/t13-/m0/s1 |
| InChIKey | PDNBZJBRYNRBAO-ZDUSSCGKSA-N |
| XLogP | 0.36 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |