About (3S)-1-[3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoyl]pyrrolidine-3-carboxylic acid
(3S)-1-[3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoyl]pyrrolidine-3-carboxylic acid (PubChem CID 124703211) has the molecular formula C17H20N2O4
and a molecular weight of 316.36 g/mol. Its IUPAC name is (3S)-1-[3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoyl]pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | (3S)-1-[3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoyl]pyrrolidine-3-carboxylic acid |
| PubChem CID | 124703211 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (3S)-1-[3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCN(C(=O)CC[C@@H]2Cc3ccccc3NC2=O)C1 |
| InChI | InChI=1S/C17H20N2O4/c20-15(19-8-7-13(10-19)17(22)23)6-5-12-9-11-3-1-2-4-14(11)18-16(12)21/h1-4,12-13H,5-10H2,(H,18,21)(H,22,23)/t12-,13+/m1/s1 |
| InChIKey | HXGSONJKOBQOPU-OLZOCXBDSA-N |
| XLogP | 1.51 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-1-[3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoyl]pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-[3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoyl]pyrrolidine-3-carboxylic acid?
The IUPAC name of (3S)-1-[3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoyl]pyrrolidine-3-carboxylic acid (CID 124703211) is (3S)-1-[3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoyl]pyrrolidine-3-carboxylic acid.
What is the SMILES notation for (3S)-1-[3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoyl]pyrrolidine-3-carboxylic acid?
The canonical SMILES for (3S)-1-[3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoyl]pyrrolidine-3-carboxylic acid is O=C(O)[C@H]1CCN(C(=O)CC[C@@H]2Cc3ccccc3NC2=O)C1.
What is the InChIKey of (3S)-1-[3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoyl]pyrrolidine-3-carboxylic acid?
The InChIKey is HXGSONJKOBQOPU-OLZOCXBDSA-N. The full InChI is InChI=1S/C17H20N2O4/c20-15(19-8-7-13(10-19)17(22)23)6-5-12-9-11-3-1-2-4-14(11)18-16(12)21/h1-4,12-13H,5-10H2,(H,18,21)(H,22,23)/t12-,13+/m1/s1.
What are the key properties of (3S)-1-[3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoyl]pyrrolidine-3-carboxylic acid?
(3S)-1-[3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoyl]pyrrolidine-3-carboxylic acid has a molecular weight of 316.36 g/mol, XLogP of 1.51, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-[3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoyl]pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 124703211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).