About (3R)-4,4-dimethyl-5-(2-methylprop-2-enoxy)pent-1-yn-3-ol
(3R)-4,4-dimethyl-5-(2-methylprop-2-enoxy)pent-1-yn-3-ol (PubChem CID 124703307) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is (3R)-4,4-dimethyl-5-(2-methylprop-2-enoxy)pent-1-yn-3-ol.
Molecular Properties
| Compound Name | (3R)-4,4-dimethyl-5-(2-methylprop-2-enoxy)pent-1-yn-3-ol |
| PubChem CID | 124703307 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (3R)-4,4-dimethyl-5-(2-methylprop-2-enoxy)pent-1-yn-3-ol |
| SMILES | C#C[C@@H](O)C(C)(C)COCC(=C)C |
| InChI | InChI=1S/C11H18O2/c1-6-10(12)11(4,5)8-13-7-9(2)3/h1,10,12H,2,7-8H2,3-5H3/t10-/m1/s1 |
| InChIKey | IGKRFXZMGVEUNE-SNVBAGLBSA-N |
| XLogP | 1.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-4,4-dimethyl-5-(2-methylprop-2-enoxy)pent-1-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4,4-dimethyl-5-(2-methylprop-2-enoxy)pent-1-yn-3-ol?
The IUPAC name of (3R)-4,4-dimethyl-5-(2-methylprop-2-enoxy)pent-1-yn-3-ol (CID 124703307) is (3R)-4,4-dimethyl-5-(2-methylprop-2-enoxy)pent-1-yn-3-ol.
What is the SMILES notation for (3R)-4,4-dimethyl-5-(2-methylprop-2-enoxy)pent-1-yn-3-ol?
The canonical SMILES for (3R)-4,4-dimethyl-5-(2-methylprop-2-enoxy)pent-1-yn-3-ol is C#C[C@@H](O)C(C)(C)COCC(=C)C.
What is the InChIKey of (3R)-4,4-dimethyl-5-(2-methylprop-2-enoxy)pent-1-yn-3-ol?
The InChIKey is IGKRFXZMGVEUNE-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H18O2/c1-6-10(12)11(4,5)8-13-7-9(2)3/h1,10,12H,2,7-8H2,3-5H3/t10-/m1/s1.
What are the key properties of (3R)-4,4-dimethyl-5-(2-methylprop-2-enoxy)pent-1-yn-3-ol?
(3R)-4,4-dimethyl-5-(2-methylprop-2-enoxy)pent-1-yn-3-ol has a molecular weight of 182.26 g/mol, XLogP of 1.60, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4,4-dimethyl-5-(2-methylprop-2-enoxy)pent-1-yn-3-ol is sourced from PubChem (CID 124703307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).