C15H18FNO4 — CID 124703729
1-[(3R)-3-(3-fluorophenyl)-3-hydroxypropanoyl]piperidine-4-carboxylic acid (PubChem CID 124703729) has the molecular formula C15H18FNO4 and a molecular weight of 295.31 g/mol. Its IUPAC name is 1-[(3R)-3-(3-fluorophenyl)-3-hydroxypropanoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(3R)-3-(3-fluorophenyl)-3-hydroxypropanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 124703729 |
| Molecular Formula | C15H18FNO4 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-[(3R)-3-(3-fluorophenyl)-3-hydroxypropanoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)C[C@@H](O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C15H18FNO4/c16-12-3-1-2-11(8-12)13(18)9-14(19)17-6-4-10(5-7-17)15(20)21/h1-3,8,10,13,18H,4-7,9H2,(H,20,21)/t13-/m1/s1 |
| InChIKey | CGAOCSUQGKAUSI-CYBMUJFWSA-N |
| XLogP | 1.57 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |