C14H17Cl2NO3 — CID 124704526
3-[(3S)-3-(3,4-dichlorophenoxy)piperidin-1-yl]propanoic acid (PubChem CID 124704526) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is 3-[(3S)-3-(3,4-dichlorophenoxy)piperidin-1-yl]propanoic acid.
| Compound Name | 3-[(3S)-3-(3,4-dichlorophenoxy)piperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 124704526 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 3-[(3S)-3-(3,4-dichlorophenoxy)piperidin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCC[C@H](Oc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H17Cl2NO3/c15-12-4-3-10(8-13(12)16)20-11-2-1-6-17(9-11)7-5-14(18)19/h3-4,8,11H,1-2,5-7,9H2,(H,18,19)/t11-/m0/s1 |
| InChIKey | KSEMNTXLFGSUFS-NSHDSACASA-N |
| XLogP | 3.31 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |