C15H21N3O4 — CID 124705021
2-[(2R)-4-(1-cyclopentylpyrazole-3-carbonyl)morpholin-2-yl]acetic acid (PubChem CID 124705021) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[(2R)-4-(1-cyclopentylpyrazole-3-carbonyl)morpholin-2-yl]acetic acid.
| Compound Name | 2-[(2R)-4-(1-cyclopentylpyrazole-3-carbonyl)morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 124705021 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-[(2R)-4-(1-cyclopentylpyrazole-3-carbonyl)morpholin-2-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1CN(C(=O)c2ccn(C3CCCC3)n2)CCO1 |
| InChI | InChI=1S/C15H21N3O4/c19-14(20)9-12-10-17(7-8-22-12)15(21)13-5-6-18(16-13)11-3-1-2-4-11/h5-6,11-12H,1-4,7-10H2,(H,19,20)/t12-/m1/s1 |
| InChIKey | CHXBIHBGECUAKR-GFCCVEGCSA-N |
| XLogP | 1.31 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |